C32H37N7O2 — CID 122534345
4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]cyclohexyl]benzamide (PubChem CID 122534345) has the molecular formula C32H37N7O2 and a molecular weight of 551.70 g/mol. Its IUPAC name is 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]cyclohexyl]benzamide.
| Compound Name | 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 122534345 |
| Molecular Formula | C32H37N7O2 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | 4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]-N-[3-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]cyclohexyl]benzamide |
| SMILES | Cc1cnc(NC2CCCC(NC(=O)c3ccc(NC(=O)/C=C/CN(C)C)cc3)C2)nc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C32H37N7O2/c1-21-19-34-32(38-30(21)27-20-33-28-11-5-4-10-26(27)28)37-25-9-6-8-24(18-25)36-31(41)22-13-15-23(16-14-22)35-29(40)12-7-17-39(2)3/h4-5,7,10-16,19-20,24-25,33H,6,8-9,17-18H2,1-3H3,(H,35,40)(H,36,41)(H,34,37,38)/b12-7+ |
| InChIKey | NRQCWXFKLWVNDO-KPKJPENVSA-N |
| XLogP | 5.14 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|