C26H25ClFN5O — CID 122534384
4-amino-N-[(1S,3R)-3-[[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide (PubChem CID 122534384) has the molecular formula C26H25ClFN5O and a molecular weight of 477.97 g/mol. Its IUPAC name is 4-amino-N-[(1S,3R)-3-[[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide.
| Compound Name | 4-amino-N-[(1S,3R)-3-[[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 122534384 |
| Molecular Formula | C26H25ClFN5O |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-amino-N-[(1S,3R)-3-[[5-chloro-4-(3H-inden-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-3-fluorobenzamide |
| SMILES | Nc1ccc(C(=O)N[C@H]2CCC[C@@H](Nc3ncc(Cl)c(C4=CCc5ccccc54)n3)C2)cc1F |
| InChI | InChI=1S/C26H25ClFN5O/c27-21-14-30-26(33-24(21)20-10-8-15-4-1-2-7-19(15)20)32-18-6-3-5-17(13-18)31-25(34)16-9-11-23(29)22(28)12-16/h1-2,4,7,9-12,14,17-18H,3,5-6,8,13,29H2,(H,31,34)(H,30,32,33)/t17-,18+/m0/s1 |
| InChIKey | WYSNSWULSNFCGJ-ZWKOTPCHSA-N |
| XLogP | 4.99 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|