About 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine
2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine (PubChem CID 122534931) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine.
Molecular Properties
| Compound Name | 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine |
| PubChem CID | 122534931 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine |
| SMILES | Cn1cc2ccc3c(c2n1)CON=C3N |
| InChI | InChI=1S/C10H10N4O/c1-14-4-6-2-3-7-8(9(6)12-14)5-15-13-10(7)11/h2-4H,5H2,1H3,(H2,11,13) |
| InChIKey | VMBFOEYBFPYSBG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine?
The IUPAC name of 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine (CID 122534931) is 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine.
What is the SMILES notation for 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine?
The canonical SMILES for 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine is Cn1cc2ccc3c(c2n1)CON=C3N.
What is the InChIKey of 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine?
The InChIKey is VMBFOEYBFPYSBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c1-14-4-6-2-3-7-8(9(6)12-14)5-15-13-10(7)11/h2-4H,5H2,1H3,(H2,11,13).
What are the key properties of 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine?
2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine has a molecular weight of 202.22 g/mol, XLogP of 0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-9H-pyrazolo[4,3-h][2,3]benzoxazin-6-amine is sourced from PubChem (CID 122534931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).