About 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine
7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine (PubChem CID 122534933) has the molecular formula C14H11FN2O
and a molecular weight of 242.25 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine.
Molecular Properties
| Compound Name | 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine |
| PubChem CID | 122534933 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine |
| SMILES | NC1=NOCc2cc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C14H11FN2O/c15-12-4-1-9(2-5-12)10-3-6-13-11(7-10)8-18-17-14(13)16/h1-7H,8H2,(H2,16,17) |
| InChIKey | GOURSKKQXDZFKJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine?
The IUPAC name of 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine (CID 122534933) is 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine.
What is the SMILES notation for 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine?
The canonical SMILES for 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine is NC1=NOCc2cc(-c3ccc(F)cc3)ccc21.
What is the InChIKey of 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine?
The InChIKey is GOURSKKQXDZFKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2O/c15-12-4-1-9(2-5-12)10-3-6-13-11(7-10)8-18-17-14(13)16/h1-7H,8H2,(H2,16,17).
What are the key properties of 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine?
7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine has a molecular weight of 242.25 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorophenyl)-1H-2,3-benzoxazin-4-amine is sourced from PubChem (CID 122534933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).