About 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one
6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 122535088) has the molecular formula C21H13F2IN4O
and a molecular weight of 502.26 g/mol. Its IUPAC name is 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 122535088 |
| Molecular Formula | C21H13F2IN4O |
| Molecular Weight | 502.26 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1c2cccnc2CN1Cc1c(F)cc(-c2ccc3nn(I)cc3c2)cc1F |
| InChI | InChI=1S/C21H13F2IN4O/c22-17-7-13(12-3-4-19-14(6-12)9-28(24)26-19)8-18(23)16(17)10-27-11-20-15(21(27)29)2-1-5-25-20/h1-9H,10-11H2 |
| InChIKey | ISUNRPJFJCLDPD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (CID 122535088) is 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one is O=C1c2cccnc2CN1Cc1c(F)cc(-c2ccc3nn(I)cc3c2)cc1F.
What is the InChIKey of 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one?
The InChIKey is ISUNRPJFJCLDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13F2IN4O/c22-17-7-13(12-3-4-19-14(6-12)9-28(24)26-19)8-18(23)16(17)10-27-11-20-15(21(27)29)2-1-5-25-20/h1-9H,10-11H2.
What are the key properties of 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one?
6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one has a molecular weight of 502.26 g/mol, XLogP of 4.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2,6-difluoro-4-(2-iodoindazol-5-yl)phenyl]methyl]-7H-pyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 122535088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).