C10H11Cl2N — CID 122535096
(2E,4E,6E)-3,7-dichloro-4-methylnona-2,4,6,8-tetraen-1-imine (PubChem CID 122535096) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is (2E,4E,6E)-3,7-dichloro-4-methylnona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6E)-3,7-dichloro-4-methylnona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 122535096 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (2E,4E,6E)-3,7-dichloro-4-methylnona-2,4,6,8-tetraen-1-imine |
| SMILES | [H]/N=C/C=C(Cl)\C(C)=C\C=C(\Cl)C=C |
| InChI | InChI=1S/C10H11Cl2N/c1-3-9(11)5-4-8(2)10(12)6-7-13/h3-7,13H,1H2,2H3/b8-4+,9-5+,10-6+,13-7+ |
| InChIKey | CBOQOCMAOGIJMZ-SFMMINMLSA-N |
| XLogP | 4.01 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|