C33H35N7O5S — CID 122535267
9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]carbamate (PubChem CID 122535267) has the molecular formula C33H35N7O5S and a molecular weight of 641.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 122535267 |
| Molecular Formula | C33H35N7O5S |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-5-amino-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]carbamate |
| SMILES | NC(=O)CC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CCCN=C(N)N)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C33H35N7O5S/c34-28(41)16-15-26(40-33(44)45-18-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23)30(43)38-25(13-7-17-37-32(35)36)29(42)31-39-24-12-5-6-14-27(24)46-31/h1-6,8-12,14,23,25-26H,7,13,15-18H2,(H2,34,41)(H,38,43)(H,40,44)(H4,35,36,37)/t25-,26-/m0/s1 |
| InChIKey | WRVPVQAIXXARDJ-UIOOFZCWSA-N |
| XLogP | 3.19 |
| TPSA | 204.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|