About S-phenyl 2,2-dimethylcyclopropane-1-carbothioate
S-phenyl 2,2-dimethylcyclopropane-1-carbothioate (PubChem CID 122535305) has the molecular formula C12H14OS
and a molecular weight of 206.31 g/mol. Its IUPAC name is S-phenyl 2,2-dimethylcyclopropane-1-carbothioate.
Molecular Properties
| Compound Name | S-phenyl 2,2-dimethylcyclopropane-1-carbothioate |
| PubChem CID | 122535305 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | S-phenyl 2,2-dimethylcyclopropane-1-carbothioate |
| SMILES | CC1(C)CC1C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C12H14OS/c1-12(2)8-10(12)11(13)14-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3 |
| InChIKey | QJZVUIPOFRIZEQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 2,2-dimethylcyclopropane-1-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 2,2-dimethylcyclopropane-1-carbothioate?
The IUPAC name of S-phenyl 2,2-dimethylcyclopropane-1-carbothioate (CID 122535305) is S-phenyl 2,2-dimethylcyclopropane-1-carbothioate.
What is the SMILES notation for S-phenyl 2,2-dimethylcyclopropane-1-carbothioate?
The canonical SMILES for S-phenyl 2,2-dimethylcyclopropane-1-carbothioate is CC1(C)CC1C(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl 2,2-dimethylcyclopropane-1-carbothioate?
The InChIKey is QJZVUIPOFRIZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14OS/c1-12(2)8-10(12)11(13)14-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3.
What are the key properties of S-phenyl 2,2-dimethylcyclopropane-1-carbothioate?
S-phenyl 2,2-dimethylcyclopropane-1-carbothioate has a molecular weight of 206.31 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 2,2-dimethylcyclopropane-1-carbothioate is sourced from PubChem (CID 122535305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).