C19H18N6O4S — CID 122535397
N-[(4R)-3'-amino-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-6-yl]-5-cyanopyridine-2-carboxamide (PubChem CID 122535397) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is N-[(4R)-3'-amino-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-6-yl]-5-cyanopyridine-2-carboxamide.
| Compound Name | N-[(4R)-3'-amino-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-6-yl]-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 122535397 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[(4R)-3'-amino-2'-methyl-1',1'-dioxospiro[2,3-dihydrochromene-4,5'-6H-1,2,4-thiadiazine]-6-yl]-5-cyanopyridine-2-carboxamide |
| SMILES | CN1C(N)=N[C@@]2(CCOc3ccc(NC(=O)c4ccc(C#N)cn4)cc32)CS1(=O)=O |
| InChI | InChI=1S/C19H18N6O4S/c1-25-18(21)24-19(11-30(25,27)28)6-7-29-16-5-3-13(8-14(16)19)23-17(26)15-4-2-12(9-20)10-22-15/h2-5,8,10H,6-7,11H2,1H3,(H2,21,24)(H,23,26)/t19-/m0/s1 |
| InChIKey | BPNSGHKALGEYEE-IBGZPJMESA-N |
| XLogP | 0.77 |
| TPSA | 150.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |