C16H25N3O4S — CID 122535399
(5S)-5-(butoxymethyl)-5-(2-methoxyphenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 122535399) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is (5S)-5-(butoxymethyl)-5-(2-methoxyphenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-(butoxymethyl)-5-(2-methoxyphenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 122535399 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (5S)-5-(butoxymethyl)-5-(2-methoxyphenyl)-2-methyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CCCCOC[C@@]1(c2ccccc2OC)CS(=O)(=O)N(C)C(N)=N1 |
| InChI | InChI=1S/C16H25N3O4S/c1-4-5-10-23-11-16(13-8-6-7-9-14(13)22-3)12-24(20,21)19(2)15(17)18-16/h6-9H,4-5,10-12H2,1-3H3,(H2,17,18)/t16-/m0/s1 |
| InChIKey | LKTYOJKKTNZCTE-INIZCTEOSA-N |
| XLogP | 1.30 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|