About N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide (PubChem CID 1225355) has the molecular formula C17H17N3OS
and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide |
| PubChem CID | 1225355 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1cccs1 |
| InChI | InChI=1S/C17H17N3OS/c1-12-16(18-17(21)15-9-6-10-22-15)13(2)20(19-12)11-14-7-4-3-5-8-14/h3-10H,11H2,1-2H3,(H,18,21) |
| InChIKey | XLEDTXGMDUADAR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide?
The IUPAC name of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide (CID 1225355) is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide.
What is the SMILES notation for N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide?
The canonical SMILES for N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide is Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1cccs1.
What is the InChIKey of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide?
The InChIKey is XLEDTXGMDUADAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3OS/c1-12-16(18-17(21)15-9-6-10-22-15)13(2)20(19-12)11-14-7-4-3-5-8-14/h3-10H,11H2,1-2H3,(H,18,21).
What are the key properties of N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide?
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide has a molecular weight of 311.41 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzyl-3,5-dimethylpyrazol-4-yl)thiophene-2-carboxamide is sourced from PubChem (CID 1225355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).