C26H31NO3 — CID 122535714
(2E,4E,6E,8E)-9-[(6R)-2,6-dimethyl-6-(phenylcarbamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 122535714) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-[(6R)-2,6-dimethyl-6-(phenylcarbamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-9-[(6R)-2,6-dimethyl-6-(phenylcarbamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 122535714 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (2E,4E,6E,8E)-9-[(6R)-2,6-dimethyl-6-(phenylcarbamoyl)cyclohexen-1-yl]-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)[C@](C)(C(=O)Nc2ccccc2)CCC1 |
| InChI | InChI=1S/C26H31NO3/c1-19(10-8-11-20(2)18-24(28)29)15-16-23-21(3)12-9-17-26(23,4)25(30)27-22-13-6-5-7-14-22/h5-8,10-11,13-16,18H,9,12,17H2,1-4H3,(H,27,30)(H,28,29)/b11-8+,16-15+,19-10+,20-18+/t26-/m1/s1 |
| InChIKey | JTKJNBPGNVDIFE-MCIYYNEHSA-N |
| XLogP | 6.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|