About 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine
5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 122535752) has the molecular formula C11H13F6NO
and a molecular weight of 289.22 g/mol. Its IUPAC name is 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine |
| PubChem CID | 122535752 |
| Molecular Formula | C11H13F6NO |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | CCCCOC1=C(C(F)(F)F)NC(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C11H13F6NO/c1-2-3-6-19-7-4-5-8(10(12,13)14)18-9(7)11(15,16)17/h4-5,8,18H,2-3,6H2,1H3 |
| InChIKey | VCKVKNURYPDTBP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
The IUPAC name of 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine (CID 122535752) is 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine.
What is the SMILES notation for 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
The canonical SMILES for 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine is CCCCOC1=C(C(F)(F)F)NC(C(F)(F)F)C=C1.
What is the InChIKey of 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
The InChIKey is VCKVKNURYPDTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F6NO/c1-2-3-6-19-7-4-5-8(10(12,13)14)18-9(7)11(15,16)17/h4-5,8,18H,2-3,6H2,1H3.
What are the key properties of 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine?
5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine has a molecular weight of 289.22 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-2,6-bis(trifluoromethyl)-1,2-dihydropyridine is sourced from PubChem (CID 122535752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).