About (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine
(Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine (PubChem CID 122535934) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine.
Molecular Properties
| Compound Name | (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine |
| PubChem CID | 122535934 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine |
| SMILES | CCCCC/N=C(/C=C\C=N\C)CCCC |
| InChI | InChI=1S/C14H26N2/c1-4-6-8-13-16-14(10-7-5-2)11-9-12-15-3/h9,11-12H,4-8,10,13H2,1-3H3/b11-9-,15-12+,16-14+ |
| InChIKey | QVIWLSGTKJUKBT-HUBSULSCSA-N |
| XLogP | 4.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine?
The IUPAC name of (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine (CID 122535934) is (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine.
What is the SMILES notation for (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine?
The canonical SMILES for (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine is CCCCC/N=C(/C=C\C=N\C)CCCC.
What is the InChIKey of (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine?
The InChIKey is QVIWLSGTKJUKBT-HUBSULSCSA-N. The full InChI is InChI=1S/C14H26N2/c1-4-6-8-13-16-14(10-7-5-2)11-9-12-15-3/h9,11-12H,4-8,10,13H2,1-3H3/b11-9-,15-12+,16-14+.
What are the key properties of (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine?
(Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine has a molecular weight of 222.38 g/mol, XLogP of 4.06, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-methyl-4-N-pentyloct-2-ene-1,4-diimine is sourced from PubChem (CID 122535934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).