About (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine
(2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine (PubChem CID 122535939) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine.
Molecular Properties
| Compound Name | (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine |
| PubChem CID | 122535939 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine |
| SMILES | [H]/N=C/C(CCCC(C)(C)CCCC)=C(C)\N=C\C |
| InChI | InChI=1S/C16H30N2/c1-6-8-11-16(4,5)12-9-10-15(13-17)14(3)18-7-2/h7,13,17H,6,8-12H2,1-5H3/b15-14-,17-13+,18-7+ |
| InChIKey | AYMJDBDHMPREEM-RZBSTAHGSA-N |
| XLogP | 5.39 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine?
The IUPAC name of (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine (CID 122535939) is (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine.
What is the SMILES notation for (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine?
The canonical SMILES for (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine is [H]/N=C/C(CCCC(C)(C)CCCC)=C(C)\N=C\C.
What is the InChIKey of (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine?
The InChIKey is AYMJDBDHMPREEM-RZBSTAHGSA-N. The full InChI is InChI=1S/C16H30N2/c1-6-8-11-16(4,5)12-9-10-15(13-17)14(3)18-7-2/h7,13,17H,6,8-12H2,1-5H3/b15-14-,17-13+,18-7+.
What are the key properties of (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine?
(2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine has a molecular weight of 250.43 g/mol, XLogP of 5.39, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[1-(ethylideneamino)ethylidene]-6,6-dimethyldecan-1-imine is sourced from PubChem (CID 122535939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).