C14H16O4 — CID 122535952
ethyl (4R)-4-[(2S)-2-formyl-2,3-dihydrofuran-5-yl]cyclohexa-1,5-diene-1-carboxylate (PubChem CID 122535952) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethyl (4R)-4-[(2S)-2-formyl-2,3-dihydrofuran-5-yl]cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | ethyl (4R)-4-[(2S)-2-formyl-2,3-dihydrofuran-5-yl]cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 122535952 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethyl (4R)-4-[(2S)-2-formyl-2,3-dihydrofuran-5-yl]cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](C2=CC[C@@H](C=O)O2)C=C1 |
| InChI | InChI=1S/C14H16O4/c1-2-17-14(16)11-5-3-10(4-6-11)13-8-7-12(9-15)18-13/h3,5-6,8-10,12H,2,4,7H2,1H3/t10-,12-/m0/s1 |
| InChIKey | PNGHFYNYOTZDGO-JQWIXIFHSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|