C21H24F2N8O — CID 122536013
5-[4-[(3aR,6aS)-4,4-difluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine (PubChem CID 122536013) has the molecular formula C21H24F2N8O and a molecular weight of 442.47 g/mol. Its IUPAC name is 5-[4-[(3aR,6aS)-4,4-difluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[4-[(3aR,6aS)-4,4-difluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122536013 |
| Molecular Formula | C21H24F2N8O |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 5-[4-[(3aR,6aS)-4,4-difluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
| SMILES | CC1(C)OCCn2c1nc1c(N3C[C@H]4CCC(F)(F)[C@H]4C3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C21H24F2N8O/c1-20(2)18-27-14-16(30-9-11-3-4-21(22,23)13(11)10-30)28-15(12-7-25-19(24)26-8-12)29-17(14)31(18)5-6-32-20/h7-8,11,13H,3-6,9-10H2,1-2H3,(H2,24,25,26)/t11-,13+/m1/s1 |
| InChIKey | BSPIPDNQMBPGAB-YPMHNXCESA-N |
| XLogP | 2.61 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |