C22H23N7O — CID 122536020
4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536020) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536020 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC4CC3C4)nc(-c3cnc4[nH]ccc4c3)nc12 |
| InChI | InChI=1S/C22H23N7O/c1-22(2)21-25-16-19(28(21)5-6-30-22)26-18(14-9-13-3-4-23-17(13)24-10-14)27-20(16)29-11-12-7-15(29)8-12/h3-4,9-10,12,15H,5-8,11H2,1-2H3,(H,23,24) |
| InChIKey | HSJDHFNJRZBOBY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |