C23H26N8O — CID 122536021
4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(3-ethyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536021) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(3-ethyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(3-ethyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536021 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(3-ethyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | CCc1[nH]nc2ncc(-c3nc(N4CC5CC4C5)c4nc5n(c4n3)CCOC5(C)C)cc12 |
| InChI | InChI=1S/C23H26N8O/c1-4-16-15-9-13(10-24-19(15)29-28-16)18-26-20-17(21(27-18)31-11-12-7-14(31)8-12)25-22-23(2,3)32-6-5-30(20)22/h9-10,12,14H,4-8,11H2,1-3H3,(H,24,28,29) |
| InChIKey | OGZCXZNJBAIVMV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |