C22H24N8O — CID 122536022
4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536022) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536022 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-6,6-dimethyl-2-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | Cc1[nH]nc2ncc(-c3nc(N4CC5CC4C5)c4nc5n(c4n3)CCOC5(C)C)cc12 |
| InChI | InChI=1S/C22H24N8O/c1-11-15-8-13(9-23-18(15)28-27-11)17-25-19-16(20(26-17)30-10-12-6-14(30)7-12)24-21-22(2,3)31-5-4-29(19)21/h8-9,12,14H,4-7,10H2,1-3H3,(H,23,27,28) |
| InChIKey | AVMRYPKMSMWCAA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |