C20H22N6O — CID 122536055
4-cyclopropyl-2-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536055) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 4-cyclopropyl-2-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-cyclopropyl-2-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536055 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 4-cyclopropyl-2-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | CC1(C)OCCn2c1nc1c(C3CC3)nc(-c3cnc4c(c3)CCN4)nc12 |
| InChI | InChI=1S/C20H22N6O/c1-20(2)19-24-15-14(11-3-4-11)23-17(25-18(15)26(19)7-8-27-20)13-9-12-5-6-21-16(12)22-10-13/h9-11H,3-8H2,1-2H3,(H,21,22) |
| InChIKey | GQTIISPVNFOWKI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |