C23H27F2N7O2 — CID 122536066
3-(cyclopropylmethoxy)-5-[4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine (PubChem CID 122536066) has the molecular formula C23H27F2N7O2 and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-5-[4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine.
| Compound Name | 3-(cyclopropylmethoxy)-5-[4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 122536066 |
| Molecular Formula | C23H27F2N7O2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 3-(cyclopropylmethoxy)-5-[4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine |
| SMILES | CC1(C)OCCn2c1nc1c(N3CCC(F)(F)C3)nc(-c3cnc(N)c(OCC4CC4)c3)nc12 |
| InChI | InChI=1S/C23H27F2N7O2/c1-22(2)21-28-16-19(31-6-5-23(24,25)12-31)29-18(30-20(16)32(21)7-8-34-22)14-9-15(17(26)27-10-14)33-11-13-3-4-13/h9-10,13H,3-8,11-12H2,1-2H3,(H2,26,27) |
| InChIKey | SOAOYZOCIJFZCK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |