C18H20F2N8O — CID 122536108
5-[4-[(3R,4S)-3,4-difluoropyrrolidin-1-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine (PubChem CID 122536108) has the molecular formula C18H20F2N8O and a molecular weight of 402.41 g/mol. Its IUPAC name is 5-[4-[(3R,4S)-3,4-difluoropyrrolidin-1-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[4-[(3R,4S)-3,4-difluoropyrrolidin-1-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122536108 |
| Molecular Formula | C18H20F2N8O |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 5-[4-[(3R,4S)-3,4-difluoropyrrolidin-1-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
| SMILES | CC1(C)OCCn2c1nc1c(N3C[C@@H](F)[C@@H](F)C3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C18H20F2N8O/c1-18(2)16-24-12-14(27-7-10(19)11(20)8-27)25-13(9-5-22-17(21)23-6-9)26-15(12)28(16)3-4-29-18/h5-6,10-11H,3-4,7-8H2,1-2H3,(H2,21,22,23)/t10-,11+ |
| InChIKey | RYJQONXCUZUCGQ-PHIMTYICSA-N |
| XLogP | 1.63 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |