C20H23F2N7O2 — CID 122536111
5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-ethoxypyridin-2-amine (PubChem CID 122536111) has the molecular formula C20H23F2N7O2 and a molecular weight of 431.45 g/mol. Its IUPAC name is 5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-ethoxypyridin-2-amine.
| Compound Name | 5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-ethoxypyridin-2-amine |
|---|---|
| PubChem CID | 122536111 |
| Molecular Formula | C20H23F2N7O2 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-ethoxypyridin-2-amine |
| SMILES | CCOc1cc(-c2nc(N3CC(F)(F)C3)c3nc4n(c3n2)CCOC4(C)C)cnc1N |
| InChI | InChI=1S/C20H23F2N7O2/c1-4-30-12-7-11(8-24-14(12)23)15-26-16(28-9-20(21,22)10-28)13-17(27-15)29-5-6-31-19(2,3)18(29)25-13/h7-8H,4-6,9-10H2,1-3H3,(H2,23,24) |
| InChIKey | PAHATUPHMZYURY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |