C21H25F2N7O2 — CID 122536113
5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-propan-2-yloxypyridin-2-amine (PubChem CID 122536113) has the molecular formula C21H25F2N7O2 and a molecular weight of 445.47 g/mol. Its IUPAC name is 5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-propan-2-yloxypyridin-2-amine.
| Compound Name | 5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-propan-2-yloxypyridin-2-amine |
|---|---|
| PubChem CID | 122536113 |
| Molecular Formula | C21H25F2N7O2 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]-3-propan-2-yloxypyridin-2-amine |
| SMILES | CC(C)Oc1cc(-c2nc(N3CC(F)(F)C3)c3nc4n(c3n2)CCOC4(C)C)cnc1N |
| InChI | InChI=1S/C21H25F2N7O2/c1-11(2)32-13-7-12(8-25-15(13)24)16-27-17(29-9-21(22,23)10-29)14-18(28-16)30-5-6-31-20(3,4)19(30)26-14/h7-8,11H,5-6,9-10H2,1-4H3,(H2,24,25) |
| InChIKey | PMKULVWLSVGPNF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |