About 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine
5-fluoro-3-methyl-2,3-dihydropyridin-6-amine (PubChem CID 122536116) has the molecular formula C6H9FN2
and a molecular weight of 128.15 g/mol. Its IUPAC name is 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine |
| PubChem CID | 122536116 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine |
| SMILES | CC1C=C(F)C(N)=NC1 |
| InChI | InChI=1S/C6H9FN2/c1-4-2-5(7)6(8)9-3-4/h2,4H,3H2,1H3,(H2,8,9) |
| InChIKey | FGGYMEPPAAROFP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine?
The IUPAC name of 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine (CID 122536116) is 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine.
What is the SMILES notation for 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine?
The canonical SMILES for 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine is CC1C=C(F)C(N)=NC1.
What is the InChIKey of 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine?
The InChIKey is FGGYMEPPAAROFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN2/c1-4-2-5(7)6(8)9-3-4/h2,4H,3H2,1H3,(H2,8,9).
What are the key properties of 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine?
5-fluoro-3-methyl-2,3-dihydropyridin-6-amine has a molecular weight of 128.15 g/mol, XLogP of 0.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-2,3-dihydropyridin-6-amine is sourced from PubChem (CID 122536116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).