C22H27F2N7O2 — CID 122536144
3-butan-2-yloxy-5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine (PubChem CID 122536144) has the molecular formula C22H27F2N7O2 and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-butan-2-yloxy-5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine.
| Compound Name | 3-butan-2-yloxy-5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 122536144 |
| Molecular Formula | C22H27F2N7O2 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-butan-2-yloxy-5-[4-(3,3-difluoroazetidin-1-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyridin-2-amine |
| SMILES | CCC(C)Oc1cc(-c2nc(N3CC(F)(F)C3)c3nc4n(c3n2)CCOC4(C)C)cnc1N |
| InChI | InChI=1S/C22H27F2N7O2/c1-5-12(2)33-14-8-13(9-26-16(14)25)17-28-18(30-10-22(23,24)11-30)15-19(29-17)31-6-7-32-21(3,4)20(31)27-15/h8-9,12H,5-7,10-11H2,1-4H3,(H2,25,26) |
| InChIKey | PPSXEENBSHMKEL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |