C24H27F2N7O — CID 122536146
4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536146) has the molecular formula C24H27F2N7O and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536146 |
| Molecular Formula | C24H27F2N7O |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-(3,3-difluoropyrrolidin-1-yl)-6,6-dimethyl-2-(3-propan-2-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | CC(C)c1c[nH]c2ncc(-c3nc(N4CCC(F)(F)C4)c4nc5n(c4n3)CCOC5(C)C)cc12 |
| InChI | InChI=1S/C24H27F2N7O/c1-13(2)16-11-28-19-15(16)9-14(10-27-19)18-30-20(32-6-5-24(25,26)12-32)17-21(31-18)33-7-8-34-23(3,4)22(33)29-17/h9-11,13H,5-8,12H2,1-4H3,(H,27,28) |
| InChIKey | BFUUINHPBZBALG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |