C20H21F2N5O2 — CID 122536152
5-(6-cyclopropyl-10,10-dimethyl-11-oxa-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-4-yl)-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 122536152) has the molecular formula C20H21F2N5O2 and a molecular weight of 401.42 g/mol. Its IUPAC name is 5-(6-cyclopropyl-10,10-dimethyl-11-oxa-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-4-yl)-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-(6-cyclopropyl-10,10-dimethyl-11-oxa-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-4-yl)-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 122536152 |
| Molecular Formula | C20H21F2N5O2 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 5-(6-cyclopropyl-10,10-dimethyl-11-oxa-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraen-4-yl)-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | CC1(C)OCCn2c1nc1c(C3CC3)nc(-c3cnc(N)c(OC(F)F)c3)cc12 |
| InChI | InChI=1S/C20H21F2N5O2/c1-20(2)18-26-16-13(27(18)5-6-28-20)8-12(25-15(16)10-3-4-10)11-7-14(29-19(21)22)17(23)24-9-11/h7-10,19H,3-6H2,1-2H3,(H2,23,24) |
| InChIKey | RPNNGAHIVTWYLS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |