C20H20ClN7O2 — CID 122536159
1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidin-3-ol (PubChem CID 122536159) has the molecular formula C20H20ClN7O2 and a molecular weight of 425.88 g/mol. Its IUPAC name is 1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidin-3-ol.
| Compound Name | 1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 122536159 |
| Molecular Formula | C20H20ClN7O2 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 1-[2-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-4-yl]azetidin-3-ol |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC(O)C3)nc(-c3cnc4[nH]cc(Cl)c4c3)nc12 |
| InChI | InChI=1S/C20H20ClN7O2/c1-20(2)19-24-14-17(27-8-11(29)9-27)25-15(26-18(14)28(19)3-4-30-20)10-5-12-13(21)7-23-16(12)22-6-10/h5-7,11,29H,3-4,8-9H2,1-2H3,(H,22,23) |
| InChIKey | YGBONFAQIIELTF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |