C21H22N8O — CID 122536178
4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine (PubChem CID 122536178) has the molecular formula C21H22N8O and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine.
| Compound Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
|---|---|
| PubChem CID | 122536178 |
| Molecular Formula | C21H22N8O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-(1H-imidazo[4,5-b]pyridin-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazine |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC4CC3C4)nc(-c3cnc4nc[nH]c4c3)nc12 |
| InChI | InChI=1S/C21H22N8O/c1-21(2)20-25-15-18(28(20)3-4-30-21)26-16(12-7-14-17(22-8-12)24-10-23-14)27-19(15)29-9-11-5-13(29)6-11/h7-8,10-11,13H,3-6,9H2,1-2H3,(H,22,23,24) |
| InChIKey | KTUZVVDCVNZIMJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |