About 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone
1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone (PubChem CID 122536254) has the molecular formula C6H10FNO2
and a molecular weight of 147.15 g/mol. Its IUPAC name is 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone |
| PubChem CID | 122536254 |
| Molecular Formula | C6H10FNO2 |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](O)[C@H](F)C1 |
| InChI | InChI=1S/C6H10FNO2/c1-4(9)8-2-5(7)6(10)3-8/h5-6,10H,2-3H2,1H3/t5-,6-/m1/s1 |
| InChIKey | SXSREWCLAPOCDH-PHDIDXHHSA-N |
| XLogP | -0.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone?
The IUPAC name of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone (CID 122536254) is 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone.
What is the SMILES notation for 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone?
The canonical SMILES for 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone is CC(=O)N1C[C@@H](O)[C@H](F)C1.
What is the InChIKey of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone?
The InChIKey is SXSREWCLAPOCDH-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H10FNO2/c1-4(9)8-2-5(7)6(10)3-8/h5-6,10H,2-3H2,1H3/t5-,6-/m1/s1.
What are the key properties of 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone?
1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone has a molecular weight of 147.15 g/mol, XLogP of -0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R,4R)-3-fluoro-4-hydroxypyrrolidin-1-yl]ethanone is sourced from PubChem (CID 122536254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).