C21H22N4O3S3 — CID 122536258
4-[4-(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine (PubChem CID 122536258) has the molecular formula C21H22N4O3S3 and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-[4-(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine.
| Compound Name | 4-[4-(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 122536258 |
| Molecular Formula | C21H22N4O3S3 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 4-[4-(2-methoxyethoxy)phenyl]-6-propylsulfinyl-2-(1,3-thiazol-2-yl)thieno[2,3-d]pyrimidin-5-amine |
| SMILES | CCCS(=O)c1sc2nc(-c3nccs3)nc(-c3ccc(OCCOC)cc3)c2c1N |
| InChI | InChI=1S/C21H22N4O3S3/c1-3-12-31(26)21-16(22)15-17(13-4-6-14(7-5-13)28-10-9-27-2)24-18(25-19(15)30-21)20-23-8-11-29-20/h4-8,11H,3,9-10,12,22H2,1-2H3 |
| InChIKey | VUZXXWICLOWVFN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|