About N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide
N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide (PubChem CID 122536268) has the molecular formula C5H7IN4O
and a molecular weight of 266.04 g/mol. Its IUPAC name is N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide.
Molecular Properties
| Compound Name | N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide |
| PubChem CID | 122536268 |
| Molecular Formula | C5H7IN4O |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide |
| SMILES | O=C(I)NCCn1cncn1 |
| InChI | InChI=1S/C5H7IN4O/c6-5(11)8-1-2-10-4-7-3-9-10/h3-4H,1-2H2,(H,8,11) |
| InChIKey | ZUGKVSGPWYPDNI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide?
The IUPAC name of N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide (CID 122536268) is N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide.
What is the SMILES notation for N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide?
The canonical SMILES for N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide is O=C(I)NCCn1cncn1.
What is the InChIKey of N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide?
The InChIKey is ZUGKVSGPWYPDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IN4O/c6-5(11)8-1-2-10-4-7-3-9-10/h3-4H,1-2H2,(H,8,11).
What are the key properties of N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide?
N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide has a molecular weight of 266.04 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-triazol-1-yl)ethyl]carbamoyl iodide is sourced from PubChem (CID 122536268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).