About 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane
5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane (PubChem CID 122536278) has the molecular formula C19H34F2O
and a molecular weight of 316.48 g/mol. Its IUPAC name is 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane.
Molecular Properties
| Compound Name | 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane |
| PubChem CID | 122536278 |
| Molecular Formula | C19H34F2O |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane |
| SMILES | C=CCCCC(CCC)OC(F)(F)CCCC(C=C)CCC |
| InChI | InChI=1S/C19H34F2O/c1-5-9-10-15-18(13-7-3)22-19(20,21)16-11-14-17(8-4)12-6-2/h5,8,17-18H,1,4,6-7,9-16H2,2-3H3 |
| InChIKey | DSIUWUPLRKKJFE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane?
The IUPAC name of 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane (CID 122536278) is 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane.
What is the SMILES notation for 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane?
The canonical SMILES for 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane is C=CCCCC(CCC)OC(F)(F)CCCC(C=C)CCC.
What is the InChIKey of 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane?
The InChIKey is DSIUWUPLRKKJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34F2O/c1-5-9-10-15-18(13-7-3)22-19(20,21)16-11-14-17(8-4)12-6-2/h5,8,17-18H,1,4,6-7,9-16H2,2-3H3.
What are the key properties of 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane?
5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane has a molecular weight of 316.48 g/mol, XLogP of 6.89, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1,1-difluoro-1-non-8-en-4-yloxyoctane is sourced from PubChem (CID 122536278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).