About 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane
1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane (PubChem CID 122536282) has the molecular formula C19H32F4O
and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane.
Molecular Properties
| Compound Name | 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane |
| PubChem CID | 122536282 |
| Molecular Formula | C19H32F4O |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane |
| SMILES | C=CC(CCC)CCCC(F)(F)OC(CCC)CCCC=C(F)F |
| InChI | InChI=1S/C19H32F4O/c1-4-10-16(6-3)12-9-15-19(22,23)24-17(11-5-2)13-7-8-14-18(20)21/h6,14,16-17H,3-5,7-13,15H2,1-2H3 |
| InChIKey | YNPXHAOXKDSMRH-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane?
The IUPAC name of 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane (CID 122536282) is 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane.
What is the SMILES notation for 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane?
The canonical SMILES for 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane is C=CC(CCC)CCCC(F)(F)OC(CCC)CCCC=C(F)F.
What is the InChIKey of 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane?
The InChIKey is YNPXHAOXKDSMRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32F4O/c1-4-10-16(6-3)12-9-15-19(22,23)24-17(11-5-2)13-7-8-14-18(20)21/h6,14,16-17H,3-5,7-13,15H2,1-2H3.
What are the key properties of 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane?
1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane has a molecular weight of 352.46 g/mol, XLogP of 7.49, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9,9-difluoronon-8-en-4-yloxy)-5-ethenyl-1,1-difluorooctane is sourced from PubChem (CID 122536282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).