About 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol
3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol (PubChem CID 122536457) has the molecular formula C9H14ClN3O2
and a molecular weight of 231.68 g/mol. Its IUPAC name is 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol |
| PubChem CID | 122536457 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)COc1nc(N)ncc1Cl |
| InChI | InChI=1S/C9H14ClN3O2/c1-9(2,4-14)5-15-7-6(10)3-12-8(11)13-7/h3,14H,4-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | NMPVDOMPZXTUMC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol (CID 122536457) is 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol is CC(C)(CO)COc1nc(N)ncc1Cl.
What is the InChIKey of 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol?
The InChIKey is NMPVDOMPZXTUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3O2/c1-9(2,4-14)5-15-7-6(10)3-12-8(11)13-7/h3,14H,4-5H2,1-2H3,(H2,11,12,13).
What are the key properties of 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol?
3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol has a molecular weight of 231.68 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-5-chloropyrimidin-4-yl)oxy-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 122536457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).