C14H13NO3 — CID 122536530
6-(cyclohexa-1,3-dien-1-ylamino)-3a,4-dihydro-2-benzofuran-1,3-dione (PubChem CID 122536530) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 6-(cyclohexa-1,3-dien-1-ylamino)-3a,4-dihydro-2-benzofuran-1,3-dione.
| Compound Name | 6-(cyclohexa-1,3-dien-1-ylamino)-3a,4-dihydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 122536530 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 6-(cyclohexa-1,3-dien-1-ylamino)-3a,4-dihydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2CC=C(NC3=CC=CCC3)C=C12 |
| InChI | InChI=1S/C14H13NO3/c16-13-11-7-6-10(8-12(11)14(17)18-13)15-9-4-2-1-3-5-9/h1-2,4,6,8,11,15H,3,5,7H2 |
| InChIKey | CULFOLOHIQOEAE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|