C28H36FN9O2 — CID 122536937
N-[3-[[[2-[[(3R,4R)-3-fluoropiperidin-4-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-prop-2-enoylpyrrolidine-3-carboxamide (PubChem CID 122536937) has the molecular formula C28H36FN9O2 and a molecular weight of 549.66 g/mol. Its IUPAC name is N-[3-[[[2-[[(3R,4R)-3-fluoropiperidin-4-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-prop-2-enoylpyrrolidine-3-carboxamide.
| Compound Name | N-[3-[[[2-[[(3R,4R)-3-fluoropiperidin-4-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-prop-2-enoylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122536937 |
| Molecular Formula | C28H36FN9O2 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | N-[3-[[[2-[[(3R,4R)-3-fluoropiperidin-4-yl]amino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]-1-prop-2-enoylpyrrolidine-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)Nc2cccc(CNc3nc(N[C@@H]4CCNC[C@H]4F)nc4c(C(C)C)cnn34)c2)C1 |
| InChI | InChI=1S/C28H36FN9O2/c1-4-24(39)37-11-9-19(16-37)26(40)33-20-7-5-6-18(12-20)13-31-28-36-27(34-23-8-10-30-15-22(23)29)35-25-21(17(2)3)14-32-38(25)28/h4-7,12,14,17,19,22-23,30H,1,8-11,13,15-16H2,2-3H3,(H,33,40)(H2,31,34,35,36)/t19?,22-,23-/m1/s1 |
| InChIKey | KGHZKXNQBOKOPW-QENMJEOYSA-N |
| XLogP | 2.94 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|