C9H15FO2 — CID 122537174
(2S,3S,4S,5S)-5-ethenyl-5-ethyl-4-fluoro-2-methyloxolan-3-ol (PubChem CID 122537174) has the molecular formula C9H15FO2 and a molecular weight of 174.21 g/mol. Its IUPAC name is (2S,3S,4S,5S)-5-ethenyl-5-ethyl-4-fluoro-2-methyloxolan-3-ol.
| Compound Name | (2S,3S,4S,5S)-5-ethenyl-5-ethyl-4-fluoro-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 122537174 |
| Molecular Formula | C9H15FO2 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | (2S,3S,4S,5S)-5-ethenyl-5-ethyl-4-fluoro-2-methyloxolan-3-ol |
| SMILES | C=C[C@]1(CC)O[C@@H](C)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C9H15FO2/c1-4-9(5-2)8(10)7(11)6(3)12-9/h4,6-8,11H,1,5H2,2-3H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | SFIIFDODURFXAY-XSPKLOCKSA-N |
| XLogP | 1.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|