About 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine
4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine (PubChem CID 122537698) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine |
| PubChem CID | 122537698 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine |
| SMILES | CC=C(C)c1c(C)nn(C)c1N |
| InChI | InChI=1S/C9H15N3/c1-5-6(2)8-7(3)11-12(4)9(8)10/h5H,10H2,1-4H3 |
| InChIKey | FPDANXDKQBMFKQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine?
The IUPAC name of 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine (CID 122537698) is 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine.
What is the SMILES notation for 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine?
The canonical SMILES for 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine is CC=C(C)c1c(C)nn(C)c1N.
What is the InChIKey of 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine?
The InChIKey is FPDANXDKQBMFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-5-6(2)8-7(3)11-12(4)9(8)10/h5H,10H2,1-4H3.
What are the key properties of 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine?
4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine has a molecular weight of 165.24 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-en-2-yl-1,3-dimethylpyrazol-5-amine is sourced from PubChem (CID 122537698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).