C20H18N2O2 — CID 122537704
3,6,8,9-tetramethyl-5-pyridin-3-ylfuro[3,2-g]quinolin-7-one (PubChem CID 122537704) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3,6,8,9-tetramethyl-5-pyridin-3-ylfuro[3,2-g]quinolin-7-one.
| Compound Name | 3,6,8,9-tetramethyl-5-pyridin-3-ylfuro[3,2-g]quinolin-7-one |
|---|---|
| PubChem CID | 122537704 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3,6,8,9-tetramethyl-5-pyridin-3-ylfuro[3,2-g]quinolin-7-one |
| SMILES | Cc1c(-c2cccnc2)c2cc3c(C)coc3c(C)c2n(C)c1=O |
| InChI | InChI=1S/C20H18N2O2/c1-11-10-24-19-13(3)18-16(8-15(11)19)17(12(2)20(23)22(18)4)14-6-5-7-21-9-14/h5-10H,1-4H3 |
| InChIKey | IRWSUHVQJLZEDE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|