C32H27ClN6O — CID 122537890
4-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-N-[(4-methoxyphenyl)methyl]benzene-1,2,4-triamine (PubChem CID 122537890) has the molecular formula C32H27ClN6O and a molecular weight of 547.06 g/mol. Its IUPAC name is 4-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-N-[(4-methoxyphenyl)methyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-N-[(4-methoxyphenyl)methyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 122537890 |
| Molecular Formula | C32H27ClN6O |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 4-N-[5-chloro-4-(1-phenylindol-3-yl)pyrimidin-2-yl]-1-N-[(4-methoxyphenyl)methyl]benzene-1,2,4-triamine |
| SMILES | COc1ccc(CNc2ccc(Nc3ncc(Cl)c(-c4cn(-c5ccccc5)c5ccccc45)n3)cc2N)cc1 |
| InChI | InChI=1S/C32H27ClN6O/c1-40-24-14-11-21(12-15-24)18-35-29-16-13-22(17-28(29)34)37-32-36-19-27(33)31(38-32)26-20-39(23-7-3-2-4-8-23)30-10-6-5-9-25(26)30/h2-17,19-20,35H,18,34H2,1H3,(H,36,37,38) |
| InChIKey | DZFWLIUFBYVOIT-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|