About methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate
methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate (PubChem CID 122538052) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate |
| PubChem CID | 122538052 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate |
| SMILES | COC(=O)C[C@](C)(N)c1ccns1 |
| InChI | InChI=1S/C8H12N2O2S/c1-8(9,5-7(11)12-2)6-3-4-10-13-6/h3-4H,5,9H2,1-2H3/t8-/m0/s1 |
| InChIKey | KYZQPPZSZOZWOB-QMMMGPOBSA-N |
| XLogP | 0.88 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate?
The IUPAC name of methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate (CID 122538052) is methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate.
What is the SMILES notation for methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate?
The canonical SMILES for methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate is COC(=O)C[C@](C)(N)c1ccns1.
What is the InChIKey of methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate?
The InChIKey is KYZQPPZSZOZWOB-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-8(9,5-7(11)12-2)6-3-4-10-13-6/h3-4H,5,9H2,1-2H3/t8-/m0/s1.
What are the key properties of methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate?
methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate has a molecular weight of 200.26 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-amino-3-(1,2-thiazol-5-yl)butanoate is sourced from PubChem (CID 122538052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).