C28H28N2O — CID 122539423
6-ethynyl-3-methyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)-2-phenylquinoline-4-carboxamide (PubChem CID 122539423) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is 6-ethynyl-3-methyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | 6-ethynyl-3-methyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 122539423 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 6-ethynyl-3-methyl-N-(4-methyl-1-bicyclo[2.2.2]octanyl)-2-phenylquinoline-4-carboxamide |
| SMILES | C#Cc1ccc2nc(-c3ccccc3)c(C)c(C(=O)NC34CCC(C)(CC3)CC4)c2c1 |
| InChI | InChI=1S/C28H28N2O/c1-4-20-10-11-23-22(18-20)24(19(2)25(29-23)21-8-6-5-7-9-21)26(31)30-28-15-12-27(3,13-16-28)14-17-28/h1,5-11,18H,12-17H2,2-3H3,(H,30,31) |
| InChIKey | OUFJEBGJBZGBET-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|