About 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide
5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide (PubChem CID 122539641) has the molecular formula C20H15F3N2O3
and a molecular weight of 388.35 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide |
| PubChem CID | 122539641 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1ccc(-c2cc(C(N)=O)ncc2OCc2cc(F)cc(F)c2)c(F)c1 |
| InChI | InChI=1S/C20H15F3N2O3/c1-27-14-2-3-15(17(23)7-14)16-8-18(20(24)26)25-9-19(16)28-10-11-4-12(21)6-13(22)5-11/h2-9H,10H2,1H3,(H2,24,26) |
| InChIKey | YTBOBHTYLRTWKU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide?
The IUPAC name of 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide (CID 122539641) is 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide.
What is the SMILES notation for 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide?
The canonical SMILES for 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide is COc1ccc(-c2cc(C(N)=O)ncc2OCc2cc(F)cc(F)c2)c(F)c1.
What is the InChIKey of 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide?
The InChIKey is YTBOBHTYLRTWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3N2O3/c1-27-14-2-3-15(17(23)7-14)16-8-18(20(24)26)25-9-19(16)28-10-11-4-12(21)6-13(22)5-11/h2-9H,10H2,1H3,(H2,24,26).
What are the key properties of 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide?
5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide has a molecular weight of 388.35 g/mol, XLogP of 3.85, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-difluorophenyl)methoxy]-4-(2-fluoro-4-methoxyphenyl)pyridine-2-carboxamide is sourced from PubChem (CID 122539641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).