C19H15F2N3O3 — CID 122539659
4-(4-fluorophenyl)-5-[2-[(5-fluoro-3-pyridinyl)oxy]ethoxy]pyridine-2-carboxamide (PubChem CID 122539659) has the molecular formula C19H15F2N3O3 and a molecular weight of 371.34 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-[2-[(5-fluoro-3-pyridinyl)oxy]ethoxy]pyridine-2-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-5-[2-[(5-fluoro-3-pyridinyl)oxy]ethoxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122539659 |
| Molecular Formula | C19H15F2N3O3 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(4-fluorophenyl)-5-[2-[(5-fluoro-3-pyridinyl)oxy]ethoxy]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2)c(OCCOc2cncc(F)c2)cn1 |
| InChI | InChI=1S/C19H15F2N3O3/c20-13-3-1-12(2-4-13)16-8-17(19(22)25)24-11-18(16)27-6-5-26-15-7-14(21)9-23-10-15/h1-4,7-11H,5-6H2,(H2,22,25) |
| InChIKey | RCVDJENESKXMKR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|