About 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide
5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide (PubChem CID 122539675) has the molecular formula C19H12F5N3O2
and a molecular weight of 409.31 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide |
| PubChem CID | 122539675 |
| Molecular Formula | C19H12F5N3O2 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(C(F)(F)F)nc2)c(OCc2cc(F)cc(F)c2)cn1 |
| InChI | InChI=1S/C19H12F5N3O2/c20-12-3-10(4-13(21)5-12)9-29-16-8-26-15(18(25)28)6-14(16)11-1-2-17(27-7-11)19(22,23)24/h1-8H,9H2,(H2,25,28) |
| InChIKey | DLCPXMULSQOGNW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide?
The IUPAC name of 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide (CID 122539675) is 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide.
What is the SMILES notation for 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide?
The canonical SMILES for 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide is NC(=O)c1cc(-c2ccc(C(F)(F)F)nc2)c(OCc2cc(F)cc(F)c2)cn1.
What is the InChIKey of 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide?
The InChIKey is DLCPXMULSQOGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F5N3O2/c20-12-3-10(4-13(21)5-12)9-29-16-8-26-15(18(25)28)6-14(16)11-1-2-17(27-7-11)19(22,23)24/h1-8H,9H2,(H2,25,28).
What are the key properties of 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide?
5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide has a molecular weight of 409.31 g/mol, XLogP of 4.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-difluorophenyl)methoxy]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine-2-carboxamide is sourced from PubChem (CID 122539675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).