About 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide
5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide (PubChem CID 122539725) has the molecular formula C20H22F3N3O2
and a molecular weight of 393.41 g/mol. Its IUPAC name is 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide |
| PubChem CID | 122539725 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccc(F)cc2)c(OCCCN2CCC(F)(F)CC2)cn1 |
| InChI | InChI=1S/C20H22F3N3O2/c21-15-4-2-14(3-5-15)16-12-17(19(24)27)25-13-18(16)28-11-1-8-26-9-6-20(22,23)7-10-26/h2-5,12-13H,1,6-11H2,(H2,24,27) |
| InChIKey | OIQMHULKBQXJQK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide?
The IUPAC name of 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide (CID 122539725) is 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide.
What is the SMILES notation for 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide?
The canonical SMILES for 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide is NC(=O)c1cc(-c2ccc(F)cc2)c(OCCCN2CCC(F)(F)CC2)cn1.
What is the InChIKey of 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide?
The InChIKey is OIQMHULKBQXJQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3N3O2/c21-15-4-2-14(3-5-15)16-12-17(19(24)27)25-13-18(16)28-11-1-8-26-9-6-20(22,23)7-10-26/h2-5,12-13H,1,6-11H2,(H2,24,27).
What are the key properties of 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide?
5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide has a molecular weight of 393.41 g/mol, XLogP of 3.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-fluorophenyl)pyridine-2-carboxamide is sourced from PubChem (CID 122539725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).