C24H27FN2O4 — CID 122539956
3-(cyclopropanecarbonyl)-6-[(2-fluorophenyl)methoxy]-1-[(4-methoxyphenyl)methyl]-1,4-diazepan-2-one (PubChem CID 122539956) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is 3-(cyclopropanecarbonyl)-6-[(2-fluorophenyl)methoxy]-1-[(4-methoxyphenyl)methyl]-1,4-diazepan-2-one.
| Compound Name | 3-(cyclopropanecarbonyl)-6-[(2-fluorophenyl)methoxy]-1-[(4-methoxyphenyl)methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 122539956 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-(cyclopropanecarbonyl)-6-[(2-fluorophenyl)methoxy]-1-[(4-methoxyphenyl)methyl]-1,4-diazepan-2-one |
| SMILES | COc1ccc(CN2CC(OCc3ccccc3F)CNC(C(=O)C3CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27FN2O4/c1-30-19-10-6-16(7-11-19)13-27-14-20(31-15-18-4-2-3-5-21(18)25)12-26-22(24(27)29)23(28)17-8-9-17/h2-7,10-11,17,20,22,26H,8-9,12-15H2,1H3 |
| InChIKey | YNMQQGCFMHLCGO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|